CAS 2360950-44-1 is the registry number for (S)-3-(3,5-Difluorophenyl)isoxazolidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3S)-3-(3,5-difluorophenyl)-1,2-oxazolidine (CAS 2360950-44-1) is a chemical compound with the molecular formula C9H9F2NO and a molecular weight of 185.17 g/mol. IUPAC name: (3S)-3-(3,5-difluorophenyl)-1,2-oxazolidine. InChIKey: MWQOCNNXCQDTRJ-VIFPVBQESA-N.
| Molecular formula | C9H9F2NO |
|---|---|
| Molecular weight | 185.17 g/mol |
| IUPAC name | (3S)-3-(3,5-difluorophenyl)-1,2-oxazolidine |
| InChIKey | MWQOCNNXCQDTRJ-VIFPVBQESA-N |
| SMILES | C1CON[C@@H]1C2=CC(=CC(=C2)F)F |
Computed by PubChem (NCBI)