Products 2360959-19-7
CAS 2360959-19-7 is the registry number for 4-(tert-Butyl) 3-methyl (R)-5-oxomorpholine-3,4-dicarboxylate, 95%. Offered by: Ambeed. Available pack sizes: 1g, 5g, 10g, 25g, 100g.
4-O-tert-butyl 3-O-methyl (3R)-5-oxomorpholine-3,4-dicarboxylate (CAS 2360959-19-7) is a chemical compound with the molecular formula C11H17NO6 and a molecular weight of 259.26 g/mol. IUPAC name: 4-O-tert-butyl 3-O-methyl (3R)-5-oxomorpholine-3,4-dicarboxylate. InChIKey: OIDCPTMVQAEUHK-SSDOTTSWSA-N.
| Molecular formula | C11H17NO6 |
|---|---|
| Molecular weight | 259.26 g/mol |
| IUPAC name | 4-O-tert-butyl 3-O-methyl (3R)-5-oxomorpholine-3,4-dicarboxylate |
| InChIKey | OIDCPTMVQAEUHK-SSDOTTSWSA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@H](COCC1=O)C(=O)OC |
Computed by PubChem (NCBI)