Products 2361636-11-3

CAS 2361636-11-3 is the registry number for 2-Amino-3-(2,5-dichlorothiazol-4-yl)propanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-amino-3-(2,5-dichloro-1,3-thiazol-4-yl)propanoic acid (CAS 2361636-11-3) is a chemical compound with the molecular formula C6H6Cl2N2O2S and a molecular weight of 241.09 g/mol. IUPAC name: 2-amino-3-(2,5-dichloro-1,3-thiazol-4-yl)propanoic acid. InChIKey: SZMPQRMBDVOLBZ-UHFFFAOYSA-N.

Identity
Molecular formulaC6H6Cl2N2O2S
Molecular weight241.09 g/mol
IUPAC name2-amino-3-(2,5-dichloro-1,3-thiazol-4-yl)propanoic acid
InChIKeySZMPQRMBDVOLBZ-UHFFFAOYSA-N
SMILESC(C1=C(SC(=N1)Cl)Cl)C(C(=O)O)N

Computed by PubChem (NCBI)