CAS 2361636-11-3 is the registry number for 2-Amino-3-(2,5-dichlorothiazol-4-yl)propanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-amino-3-(2,5-dichloro-1,3-thiazol-4-yl)propanoic acid (CAS 2361636-11-3) is a chemical compound with the molecular formula C6H6Cl2N2O2S and a molecular weight of 241.09 g/mol. IUPAC name: 2-amino-3-(2,5-dichloro-1,3-thiazol-4-yl)propanoic acid. InChIKey: SZMPQRMBDVOLBZ-UHFFFAOYSA-N.
| Molecular formula | C6H6Cl2N2O2S |
|---|---|
| Molecular weight | 241.09 g/mol |
| IUPAC name | 2-amino-3-(2,5-dichloro-1,3-thiazol-4-yl)propanoic acid |
| InChIKey | SZMPQRMBDVOLBZ-UHFFFAOYSA-N |
| SMILES | C(C1=C(SC(=N1)Cl)Cl)C(C(=O)O)N |
Computed by PubChem (NCBI)