CAS 6775-66-2 is the registry number for 2,5-Dichlorobenzenesulfonohydrazide, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg.
2,5-dichlorobenzenesulfonohydrazide (CAS 6775-66-2) is a chemical compound with the molecular formula C6H6Cl2N2O2S and a molecular weight of 241.09 g/mol. IUPAC name: 2,5-dichlorobenzenesulfonohydrazide. InChIKey: NPNJLPUAEPWAIT-UHFFFAOYSA-N.
| Molecular formula | C6H6Cl2N2O2S |
|---|---|
| Molecular weight | 241.09 g/mol |
| IUPAC name | 2,5-dichlorobenzenesulfonohydrazide |
| InChIKey | NPNJLPUAEPWAIT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)S(=O)(=O)NN)Cl |
Computed by PubChem (NCBI)