CAS 944058-90-6 is the registry number for 2,4-Dichloro-6-((methylsulfonyl)methyl)pyrimidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,4-dichloro-6-(methylsulfonylmethyl)pyrimidine (CAS 944058-90-6) is a chemical compound with the molecular formula C6H6Cl2N2O2S and a molecular weight of 241.09 g/mol. IUPAC name: 2,4-dichloro-6-(methylsulfonylmethyl)pyrimidine. InChIKey: XWBKVIYQDHDRBZ-UHFFFAOYSA-N.
| Molecular formula | C6H6Cl2N2O2S |
|---|---|
| Molecular weight | 241.09 g/mol |
| IUPAC name | 2,4-dichloro-6-(methylsulfonylmethyl)pyrimidine |
| InChIKey | XWBKVIYQDHDRBZ-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)CC1=CC(=NC(=N1)Cl)Cl |
Computed by PubChem (NCBI)