CAS 6655-74-9 is the registry number for 3,4-Dichlorobenzenesulphonylhydrazide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
3,4-dichlorobenzenesulfonohydrazide (CAS 6655-74-9) is a chemical compound with the molecular formula C6H6Cl2N2O2S and a molecular weight of 241.09 g/mol. IUPAC name: 3,4-dichlorobenzenesulfonohydrazide. InChIKey: FKLGJXZMKOGQAF-UHFFFAOYSA-N.
| Molecular formula | C6H6Cl2N2O2S |
|---|---|
| Molecular weight | 241.09 g/mol |
| IUPAC name | 3,4-dichlorobenzenesulfonohydrazide |
| InChIKey | FKLGJXZMKOGQAF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1S(=O)(=O)NN)Cl)Cl |
Computed by PubChem (NCBI)