Products 2361644-12-2
CAS 2361644-12-2 is the registry number for 1,5-Dimethyl-9-azabicyclo(3.3.1)nonan-3-one hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1,5-dimethyl-9-azabicyclo[3.3.1]nonan-3-one;hydrochloride (CAS 2361644-12-2) is a chemical compound with the molecular formula C10H18ClNO and a molecular weight of 203.71 g/mol. IUPAC name: 1,5-dimethyl-9-azabicyclo[3.3.1]nonan-3-one;hydrochloride. InChIKey: FUPUIRXWYFYJNV-UHFFFAOYSA-N.
| Molecular formula | C10H18ClNO |
|---|---|
| Molecular weight | 203.71 g/mol |
| IUPAC name | 1,5-dimethyl-9-azabicyclo[3.3.1]nonan-3-one;hydrochloride |
| InChIKey | FUPUIRXWYFYJNV-UHFFFAOYSA-N |
| SMILES | CC12CCCC(N1)(CC(=O)C2)C.Cl |
Computed by PubChem (NCBI)