Products 2361923-36-4
CAS 2361923-36-4 is the registry number for (S)-2-(1-(tert-Butoxycarbonyl)pyrrolidin-3-yl)benzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2-[(3S)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-3-yl]benzoic acid (CAS 2361923-36-4) is a chemical compound with the molecular formula C16H21NO4 and a molecular weight of 291.34 g/mol. IUPAC name: 2-[(3S)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-3-yl]benzoic acid. InChIKey: KNEBKWUFRVXIRI-LLVKDONJSA-N.
| Molecular formula | C16H21NO4 |
|---|---|
| Molecular weight | 291.34 g/mol |
| IUPAC name | 2-[(3S)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-3-yl]benzoic acid |
| InChIKey | KNEBKWUFRVXIRI-LLVKDONJSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](C1)C2=CC=CC=C2C(=O)O |
Computed by PubChem (NCBI)