Products 2364537-40-4
CAS 2364537-40-4 is the registry number for N-(2-Methylnaphthalen-1-yl)-6-oxo-1,6-dihydropyridine-2-carboxamide, 97%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
N-(2-methylnaphthalen-1-yl)-6-oxo-1H-pyridine-2-carboxamide (CAS 2364537-40-4) is a chemical compound with the molecular formula C17H14N2O2 and a molecular weight of 278.30 g/mol. IUPAC name: N-(2-methylnaphthalen-1-yl)-6-oxo-1H-pyridine-2-carboxamide. InChIKey: ZOILZTPLSMUESM-UHFFFAOYSA-N.
| Molecular formula | C17H14N2O2 |
|---|---|
| Molecular weight | 278.30 g/mol |
| IUPAC name | N-(2-methylnaphthalen-1-yl)-6-oxo-1H-pyridine-2-carboxamide |
| InChIKey | ZOILZTPLSMUESM-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=CC=CC=C2C=C1)NC(=O)C3=CC=CC(=O)N3 |
Computed by PubChem (NCBI)