Products 2364591-80-8
CAS 2364591-80-8 appears in our catalog under these names: 5–endo–BCN–pentanoic acid, 5-Endo-BCN-pentanoic acid, 5-[[[(1α,8α,9β)-Bicyclo[6.1.0]non-4-yn-9-ylmethoxy]carbonyl]amino]pentanoic acid, 98%, 98%, 5-endo-BCN-pentanoic acid, 95.0%. Offered by: GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 100mg, 250mg, 50mg, 500mg, 5 mg, 25 mg, 50 mg, 10 mg.
5-(9-bicyclo[6.1.0]non-4-ynylmethoxycarbonylamino)pentanoic acid (CAS 2364591-80-8) is a chemical compound with the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. IUPAC name: 5-(9-bicyclo[6.1.0]non-4-ynylmethoxycarbonylamino)pentanoic acid. InChIKey: SHBBGNJSLQPJLH-UHFFFAOYSA-N.
| Molecular formula | C16H23NO4 |
|---|---|
| Molecular weight | 293.36 g/mol |
| IUPAC name | 5-(9-bicyclo[6.1.0]non-4-ynylmethoxycarbonylamino)pentanoic acid |
| InChIKey | SHBBGNJSLQPJLH-UHFFFAOYSA-N |
| SMILES | C1CC2C(C2COC(=O)NCCCCC(=O)O)CCC#C1 |
Computed by PubChem (NCBI)