CAS 2365398-47-4 is the registry number for (2R,3R)-3-(Methoxycarbonyl)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
(2R,3R)-3-methoxycarbonylbicyclo[2.2.1]hept-5-ene-2-carboxylic acid (CAS 2365398-47-4) is a chemical compound with the molecular formula C10H12O4 and a molecular weight of 196.20 g/mol. IUPAC name: (2R,3R)-3-methoxycarbonylbicyclo[2.2.1]hept-5-ene-2-carboxylic acid. InChIKey: JYZKYCYHXBQTCY-DWYQZRHDSA-N.
| Molecular formula | C10H12O4 |
|---|---|
| Molecular weight | 196.20 g/mol |
| IUPAC name | (2R,3R)-3-methoxycarbonylbicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| InChIKey | JYZKYCYHXBQTCY-DWYQZRHDSA-N |
| SMILES | COC(=O)[C@H]1[C@@H](C2CC1C=C2)C(=O)O |
Computed by PubChem (NCBI)