CAS 4883-79-8 appears in our catalog under these names: Mono-methyl cis-5-norbornene-endo-2,3-dicarboxylate, 95%, rel-(1R,2S,3R,4S)-3-(Methoxycarbonyl)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid, 98%. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 5g, on request.
(1R,2S,3R,4S)-3-methoxycarbonylbicyclo[2.2.1]hept-5-ene-2-carboxylic acid (CAS 4883-79-8) is a chemical compound with the molecular formula C10H12O4 and a molecular weight of 196.20 g/mol. IUPAC name: (1R,2S,3R,4S)-3-methoxycarbonylbicyclo[2.2.1]hept-5-ene-2-carboxylic acid. InChIKey: JYZKYCYHXBQTCY-FKSUSPILSA-N.
| Molecular formula | C10H12O4 |
|---|---|
| Molecular weight | 196.20 g/mol |
| IUPAC name | (1R,2S,3R,4S)-3-methoxycarbonylbicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| InChIKey | JYZKYCYHXBQTCY-FKSUSPILSA-N |
| SMILES | COC(=O)[C@@H]1[C@H]2C[C@@H]([C@@H]1C(=O)O)C=C2 |
Computed by PubChem (NCBI)