Products 2365471-64-1
CAS 2365471-64-1 appears in our catalog under these names: AB–FUBINACA isomer 2, Ab-fubinaca isomer 2. Offered by: GLPBio, Biosynth. Available pack sizes: 1mg, 10mg, 5mg, 25mg, 50mg.
N-(1-amino-2-methyl-1-oxobutan-2-yl)-1-[(4-fluorophenyl)methyl]indazole-3-carboxamide (CAS 2365471-64-1) is a chemical compound with the molecular formula C20H21FN4O2 and a molecular weight of 368.4 g/mol. IUPAC name: N-(1-amino-2-methyl-1-oxobutan-2-yl)-1-[(4-fluorophenyl)methyl]indazole-3-carboxamide. InChIKey: SGXRGVNSKNQWSC-UHFFFAOYSA-N.
| Molecular formula | C20H21FN4O2 |
|---|---|
| Molecular weight | 368.4 g/mol |
| IUPAC name | N-(1-amino-2-methyl-1-oxobutan-2-yl)-1-[(4-fluorophenyl)methyl]indazole-3-carboxamide |
| InChIKey | SGXRGVNSKNQWSC-UHFFFAOYSA-N |
| SMILES | CCC(C)(C(=O)N)NC(=O)C1=NN(C2=CC=CC=C21)CC3=CC=C(C=C3)F |
Computed by PubChem (NCBI)