Products 2365501-63-7
CAS 2365501-63-7 is the registry number for Clausenalansine B. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-methoxy-3-methyl-9H-carbazol-2-ol (CAS 2365501-63-7) is a chemical compound with the molecular formula C14H13NO2 and a molecular weight of 227.26 g/mol. IUPAC name: 1-methoxy-3-methyl-9H-carbazol-2-ol. InChIKey: GYGRDHRFWPYKTF-UHFFFAOYSA-N.
| Molecular formula | C14H13NO2 |
|---|---|
| Molecular weight | 227.26 g/mol |
| IUPAC name | 1-methoxy-3-methyl-9H-carbazol-2-ol |
| InChIKey | GYGRDHRFWPYKTF-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C(=C1O)OC)NC3=CC=CC=C32 |
Computed by PubChem (NCBI)