Products 2366153-27-5
CAS 2366153-27-5 is the registry number for 1,6,8-Trihydroxy-2,7-dimethoxy-3-methylanthraquinone. Offered by: MedChemExpress. Available pack sizes: Get quote.
1,3,8-trihydroxy-2,7-dimethoxy-6-methylanthracene-9,10-dione (CAS 2366153-27-5) is a chemical compound with the molecular formula C17H14O7 and a molecular weight of 330.29 g/mol. IUPAC name: 1,3,8-trihydroxy-2,7-dimethoxy-6-methylanthracene-9,10-dione. InChIKey: DRYGOVWSWIXJID-UHFFFAOYSA-N.
| Molecular formula | C17H14O7 |
|---|---|
| Molecular weight | 330.29 g/mol |
| IUPAC name | 1,3,8-trihydroxy-2,7-dimethoxy-6-methylanthracene-9,10-dione |
| InChIKey | DRYGOVWSWIXJID-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C(=C1OC)O)C(=O)C3=C(C(=C(C=C3C2=O)O)OC)O |
Computed by PubChem (NCBI)