Products 2366239-13-4
CAS 2366239-13-4 appears in our catalog under these names: 4–Amino–3,5–diisopropylbenzoicacid, 4-Amino-3,5-diisopropylbenzoic acid, 97%, 4-Amino-3,5-bis(1-methylethyl)benzoic acid, 97%, 97%. Offered by: GLPBio, Fluorochem, Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g.
4-amino-3,5-di(propan-2-yl)benzoic acid (CAS 2366239-13-4) is a chemical compound with the molecular formula C13H19NO2 and a molecular weight of 221.29 g/mol. IUPAC name: 4-amino-3,5-di(propan-2-yl)benzoic acid. InChIKey: JNQKPABTMFSVRA-UHFFFAOYSA-N.
| Molecular formula | C13H19NO2 |
|---|---|
| Molecular weight | 221.29 g/mol |
| IUPAC name | 4-amino-3,5-di(propan-2-yl)benzoic acid |
| InChIKey | JNQKPABTMFSVRA-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=CC(=C1N)C(C)C)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
4-Amino-3,5-diisopropylbenzoic acid, 4-Amino-3,5-diisopropylbenzoicacid, 4-Amino-3,5-bis(1-methylethyl)benzoic acid, Benzoic acid, 4-amino-3,5-bis(1-methylethyl)-, Benzoic acid, 4-?amino-?3,?5-?bis(1-?methylethyl)?-, 4-amino-3,5-diisopropyl-benzoic acid, 4-amino-3,5-di(propan-2-yl)benzoic acid, 4-amino-3,5-bis(propan-2-yl)benzoic acid, Benzoic acid, 4-?amino-?3,?5-?bis(2-?methylethyl)?-