CAS 2368223-39-4 is the registry number for 2-(Methylcarboxy)pyridine-5-boronic Acid Pinacol Ester-D3. Offered by: TRC. Available pack sizes: 100mg.
Methyl 3,4,6-trideuterio-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carboxylate (CAS 2368223-39-4) is a chemical compound with the molecular formula C13H18BNO4 and a molecular weight of 266.12 g/mol. IUPAC name: methyl 3,4,6-trideuterio-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carboxylate. InChIKey: IXKFGVRURWXXKX-AYBVGXBASA-N.
| Molecular formula | C13H18BNO4 |
|---|---|
| Molecular weight | 266.12 g/mol |
| IUPAC name | methyl 3,4,6-trideuterio-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carboxylate |
| InChIKey | IXKFGVRURWXXKX-AYBVGXBASA-N |
| SMILES | [2H]C1=C(C(=NC(=C1B2OC(C(O2)(C)C)(C)C)[2H])C(=O)OC)[2H] |
Computed by PubChem (NCBI)