CAS 2369-13-3 appears in our catalog under these names: 3–Fluoro–4–nitroaniline, 3-Fluoro-4-nitroaniline, 3-Fluoro-4-nitroaniline 98%, 3-Fluoro-4-nitroaniline, 95%, 3-Fluoro-4-nitroaniline, >95.0%(GC). Offered by: GLPBio, Biosynth, Ambeed, Fluorochem, TCI. Available pack sizes: 100g, 25g, 250g, 5g, 10g, 500g, 1000g, 1g.
3-fluoro-4-nitroaniline (CAS 2369-13-3) is a chemical compound with the molecular formula C6H5FN2O2 and a molecular weight of 156.11 g/mol. IUPAC name: 3-fluoro-4-nitroaniline. InChIKey: KKQPNAPYVIIXFB-UHFFFAOYSA-N.
| Molecular formula | C6H5FN2O2 |
|---|---|
| Molecular weight | 156.11 g/mol |
| IUPAC name | 3-fluoro-4-nitroaniline |
| InChIKey | KKQPNAPYVIIXFB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)