Products 237062-38-3

CAS 237062-38-3 is the registry number for 3-(1-Pyrrolidinyl)butanoic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

3-pyrrolidin-1-ylbutanoic acid;hydrochloride (CAS 237062-38-3) is a chemical compound with the molecular formula C8H16ClNO2 and a molecular weight of 193.67 g/mol. IUPAC name: 3-pyrrolidin-1-ylbutanoic acid;hydrochloride. InChIKey: LGFPBIPWPXYVNX-UHFFFAOYSA-N.

Identity
Molecular formulaC8H16ClNO2
Molecular weight193.67 g/mol
IUPAC name3-pyrrolidin-1-ylbutanoic acid;hydrochloride
InChIKeyLGFPBIPWPXYVNX-UHFFFAOYSA-N
SMILESCC(CC(=O)O)N1CCCC1.Cl

Computed by PubChem (NCBI)