Products 23713-85-1
CAS 23713-85-1 appears in our catalog under these names: (2E,2'E)-3,3'-(1,4-Phenylene)bis[2-propenoic acid] 98%, (2E,2'E)-3,3'-(1,4-Phenylene)bis[2-propenoic acid], 98%, 98%. Offered by: Ambeed, Chemat. Available pack sizes: 1g, 5g, 25g.
(E)-3-[4-[(E)-2-carboxyethenyl]phenyl]prop-2-enoic acid (CAS 23713-85-1) is a chemical compound with the molecular formula C12H10O4 and a molecular weight of 218.20 g/mol. IUPAC name: (E)-3-[4-[(E)-2-carboxyethenyl]phenyl]prop-2-enoic acid. InChIKey: AAFXQFIGKBLKMC-KQQUZDAGSA-N.
| Molecular formula | C12H10O4 |
|---|---|
| Molecular weight | 218.20 g/mol |
| IUPAC name | (E)-3-[4-[(E)-2-carboxyethenyl]phenyl]prop-2-enoic acid |
| InChIKey | AAFXQFIGKBLKMC-KQQUZDAGSA-N |
| SMILES | C1=CC(=CC=C1/C=C/C(=O)O)/C=C/C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
1,4-Phenylenediacrylic acid, p-Benzenediacrylic acid, 2-Propenoic acid, 3,3'-(1,4-phenylene)bis-, (E,E)-, 3,3'-(1,4-Phenylene)bis-2-propenoic acid, Phenylene)bis-2-propenoic acid, 3,3'-(1,4-, 2-Propenoic acid, 3,3'-(1,4-phenylene)bis-, (2E,2'E)-, 1,4-Benzenediacrylic acid, p-Phenylenediacrylic acid, 2-Propenoic acid, 3,3'-(1,4-phenylene)bis-, (2E,2'E)-3,3'-(1,4-Phenylene)bis[2-propenoic acid]