CAS 23740-25-2 appears in our catalog under these names: Lanuginosine, Lanuginosine, 98.27%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 10 mg, 25 mg, 5 mg.
16-methoxy-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),7,9,11,14(19),15,17-octaen-13-one (CAS 23740-25-2) is a chemical compound with the molecular formula C18H11NO4 and a molecular weight of 305.3 g/mol. IUPAC name: 16-methoxy-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),7,9,11,14(19),15,17-octaen-13-one. InChIKey: WLXLLQQGGGHOMA-UHFFFAOYSA-N.
| Molecular formula | C18H11NO4 |
|---|---|
| Molecular weight | 305.3 g/mol |
| IUPAC name | 16-methoxy-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),7,9,11,14(19),15,17-octaen-13-one |
| InChIKey | WLXLLQQGGGHOMA-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C3=C4C(=CC5=C3OCO5)C=CN=C4C2=O |
Computed by PubChem (NCBI)