CAS 2505146-00-7 is the registry number for PARP1-IN-46. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-methoxy-6H-benzo[b]phenanthridine-5,7,12-trione (CAS 2505146-00-7) is a chemical compound with the molecular formula C18H11NO4 and a molecular weight of 305.3 g/mol. IUPAC name: 2-methoxy-6H-benzo[b]phenanthridine-5,7,12-trione. InChIKey: IDYPPYZJHHZRDU-UHFFFAOYSA-N.
| Molecular formula | C18H11NO4 |
|---|---|
| Molecular weight | 305.3 g/mol |
| IUPAC name | 2-methoxy-6H-benzo[b]phenanthridine-5,7,12-trione |
| InChIKey | IDYPPYZJHHZRDU-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C(=O)NC3=C2C(=O)C4=CC=CC=C4C3=O |
Computed by PubChem (NCBI)