CAS 28200-65-9 is the registry number for Lauterine. Offered by: Biosynth, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, Get quote.
17-methoxy-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),7,9,11,14(19),15,17-octaen-13-one (CAS 28200-65-9) is a chemical compound with the molecular formula C18H11NO4 and a molecular weight of 305.3 g/mol. IUPAC name: 17-methoxy-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),7,9,11,14(19),15,17-octaen-13-one. InChIKey: BHFUORVSBHCRKK-UHFFFAOYSA-N.
| Molecular formula | C18H11NO4 |
|---|---|
| Molecular weight | 305.3 g/mol |
| IUPAC name | 17-methoxy-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),7,9,11,14(19),15,17-octaen-13-one |
| InChIKey | BHFUORVSBHCRKK-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C(=O)C3=NC=CC4=CC5=C(C2=C43)OCO5 |
Computed by PubChem (NCBI)