Products 873075-19-5
CAS 873075-19-5 is the registry number for TNKS modulator-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
Cyanomethyl 4-(4-oxochromen-2-yl)benzoate (CAS 873075-19-5) is a chemical compound with the molecular formula C18H11NO4 and a molecular weight of 305.3 g/mol. IUPAC name: cyanomethyl 4-(4-oxochromen-2-yl)benzoate. InChIKey: VHZDBQAQWIEXCK-UHFFFAOYSA-N.
| Molecular formula | C18H11NO4 |
|---|---|
| Molecular weight | 305.3 g/mol |
| IUPAC name | cyanomethyl 4-(4-oxochromen-2-yl)benzoate |
| InChIKey | VHZDBQAQWIEXCK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C=C(O2)C3=CC=C(C=C3)C(=O)OCC#N |
Computed by PubChem (NCBI)