Products 2375165-52-7
CAS 2375165-52-7 is the registry number for 3-ethynyl-3-fluoro-pyrrolidine hydrochloride. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
Tert-butyl (3R,4R)-4-(hydroxymethyl)-3-methoxypiperidine-1-carboxylate (CAS 2375165-52-7) is a chemical compound with the molecular formula C12H23NO4 and a molecular weight of 245.32 g/mol. IUPAC name: tert-butyl (3R,4R)-4-(hydroxymethyl)-3-methoxypiperidine-1-carboxylate. InChIKey: JOSHOXKNFUGGDA-ZJUUUORDSA-N.
| Molecular formula | C12H23NO4 |
|---|---|
| Molecular weight | 245.32 g/mol |
| IUPAC name | tert-butyl (3R,4R)-4-(hydroxymethyl)-3-methoxypiperidine-1-carboxylate |
| InChIKey | JOSHOXKNFUGGDA-ZJUUUORDSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H]([C@H](C1)OC)CO |
Computed by PubChem (NCBI)