CAS 2375194-51-5 is the registry number for 7-Bromo-1H-pyrrolo[3,2-c]pyridine-3-carboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
7-bromo-1H-pyrrolo[3,2-c]pyridine-3-carboxylic acid (CAS 2375194-51-5) is a chemical compound with the molecular formula C8H5BrN2O2 and a molecular weight of 241.04 g/mol. IUPAC name: 7-bromo-1H-pyrrolo[3,2-c]pyridine-3-carboxylic acid. InChIKey: UGHWMRDFFPJHPE-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2O2 |
|---|---|
| Molecular weight | 241.04 g/mol |
| IUPAC name | 7-bromo-1H-pyrrolo[3,2-c]pyridine-3-carboxylic acid |
| InChIKey | UGHWMRDFFPJHPE-UHFFFAOYSA-N |
| SMILES | C1=C(C2=CN=CC(=C2N1)Br)C(=O)O |
Computed by PubChem (NCBI)