Products 2375249-12-8
CAS 2375249-12-8 is the registry number for tert-Butyl (4R)-4-{((tert-butoxy)carbonyl)amino}-5-oxopentanoate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Tert-butyl (4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate (CAS 2375249-12-8) is a chemical compound with the molecular formula C14H25NO5 and a molecular weight of 287.35 g/mol. IUPAC name: tert-butyl (4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate. InChIKey: LDUGHSSAMOWUMF-SNVBAGLBSA-N.
| Molecular formula | C14H25NO5 |
|---|---|
| Molecular weight | 287.35 g/mol |
| IUPAC name | tert-butyl (4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate |
| InChIKey | LDUGHSSAMOWUMF-SNVBAGLBSA-N |
| SMILES | CC(C)(C)OC(=O)CC[C@H](C=O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)