CAS 2375267-42-6 is the registry number for 3-(Azetidin-3-yloxy)benzoic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-(azetidin-3-yloxy)benzoic acid;hydrochloride (CAS 2375267-42-6) is a chemical compound with the molecular formula C10H12ClNO3 and a molecular weight of 229.66 g/mol. IUPAC name: 3-(azetidin-3-yloxy)benzoic acid;hydrochloride. InChIKey: CXHGOOILKNWNBG-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO3 |
|---|---|
| Molecular weight | 229.66 g/mol |
| IUPAC name | 3-(azetidin-3-yloxy)benzoic acid;hydrochloride |
| InChIKey | CXHGOOILKNWNBG-UHFFFAOYSA-N |
| SMILES | C1C(CN1)OC2=CC=CC(=C2)C(=O)O.Cl |
Computed by PubChem (NCBI)