CAS 2375267-76-6 is the registry number for 3-(2-Amino-2-carboxyethyl)pyridin-1-ium-1-olate hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-amino-3-(1-oxidopyridin-1-ium-3-yl)propanoic acid;hydrochloride (CAS 2375267-76-6) is a chemical compound with the molecular formula C8H11ClN2O3 and a molecular weight of 218.64 g/mol. IUPAC name: 2-amino-3-(1-oxidopyridin-1-ium-3-yl)propanoic acid;hydrochloride. InChIKey: MEBFPWRITMCYLR-UHFFFAOYSA-N.
| Molecular formula | C8H11ClN2O3 |
|---|---|
| Molecular weight | 218.64 g/mol |
| IUPAC name | 2-amino-3-(1-oxidopyridin-1-ium-3-yl)propanoic acid;hydrochloride |
| InChIKey | MEBFPWRITMCYLR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C[N+](=C1)[O-])CC(C(=O)O)N.Cl |
Computed by PubChem (NCBI)