Products 2375274-00-1
CAS 2375274-00-1 is the registry number for 3-{((9H-Fluoren-9-yl)methoxy)carbonyl}-3-azabicyclo(3.1.1)heptane-1-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-(9H-fluoren-9-ylmethoxycarbonyl)-3-azabicyclo[3.1.1]heptane-1-carboxylic acid (CAS 2375274-00-1) is a chemical compound with the molecular formula C22H21NO4 and a molecular weight of 363.4 g/mol. IUPAC name: 3-(9H-fluoren-9-ylmethoxycarbonyl)-3-azabicyclo[3.1.1]heptane-1-carboxylic acid. InChIKey: ILKUNSQFIUBFSL-UHFFFAOYSA-N.
| Molecular formula | C22H21NO4 |
|---|---|
| Molecular weight | 363.4 g/mol |
| IUPAC name | 3-(9H-fluoren-9-ylmethoxycarbonyl)-3-azabicyclo[3.1.1]heptane-1-carboxylic acid |
| InChIKey | ILKUNSQFIUBFSL-UHFFFAOYSA-N |
| SMILES | C1C2CC1(CN(C2)C(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35)C(=O)O |
Computed by PubChem (NCBI)