CAS 2377028-43-6 is the registry number for (3,4-Dimethoxyphenyl)acetonitrile-d6. Offered by: TRC. Available pack sizes: 10mg.
2-[3,4-bis(trideuteriomethoxy)phenyl]acetonitrile (CAS 2377028-43-6) is a chemical compound with the molecular formula C10H11NO2 and a molecular weight of 183.24 g/mol. IUPAC name: 2-[3,4-bis(trideuteriomethoxy)phenyl]acetonitrile. InChIKey: ASLSUMISAQDOOB-WFGJKAKNSA-N.
| Molecular formula | C10H11NO2 |
|---|---|
| Molecular weight | 183.24 g/mol |
| IUPAC name | 2-[3,4-bis(trideuteriomethoxy)phenyl]acetonitrile |
| InChIKey | ASLSUMISAQDOOB-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])OC1=C(C=C(C=C1)CC#N)OC([2H])([2H])[2H] |
Computed by PubChem (NCBI)