Products 2377473-34-0
CAS 2377473-34-0 is the registry number for 3-Fluoro-2,2,6,6-tetramethylpiperidin-4-one, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3-fluoro-2,2,6,6-tetramethylpiperidin-4-one (CAS 2377473-34-0) is a chemical compound with the molecular formula C9H16FNO and a molecular weight of 173.23 g/mol. IUPAC name: 3-fluoro-2,2,6,6-tetramethylpiperidin-4-one. InChIKey: GLSQHHRUCJJNFG-UHFFFAOYSA-N.
| Molecular formula | C9H16FNO |
|---|---|
| Molecular weight | 173.23 g/mol |
| IUPAC name | 3-fluoro-2,2,6,6-tetramethylpiperidin-4-one |
| InChIKey | GLSQHHRUCJJNFG-UHFFFAOYSA-N |
| SMILES | CC1(CC(=O)C(C(N1)(C)C)F)C |
Computed by PubChem (NCBI)