CAS 2378279-82-2 is the registry number for 2,2-Dimethyl-propionic acid 1H-indol-5-yl ester, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g.
1H-indol-5-yl 2,2-dimethylpropanoate (CAS 2378279-82-2) is a chemical compound with the molecular formula C13H15NO2 and a molecular weight of 217.26 g/mol. IUPAC name: 1H-indol-5-yl 2,2-dimethylpropanoate. InChIKey: BGSXXISWBJJUFB-UHFFFAOYSA-N.
| Molecular formula | C13H15NO2 |
|---|---|
| Molecular weight | 217.26 g/mol |
| IUPAC name | 1H-indol-5-yl 2,2-dimethylpropanoate |
| InChIKey | BGSXXISWBJJUFB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)OC1=CC2=C(C=C1)NC=C2 |
Computed by PubChem (NCBI)