Products 2378279-82-2

CAS 2378279-82-2 is the registry number for 2,2-Dimethyl-propionic acid 1H-indol-5-yl ester, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

1H-indol-5-yl 2,2-dimethylpropanoate (CAS 2378279-82-2) is a chemical compound with the molecular formula C13H15NO2 and a molecular weight of 217.26 g/mol. IUPAC name: 1H-indol-5-yl 2,2-dimethylpropanoate. InChIKey: BGSXXISWBJJUFB-UHFFFAOYSA-N.

Identity
Molecular formulaC13H15NO2
Molecular weight217.26 g/mol
IUPAC name1H-indol-5-yl 2,2-dimethylpropanoate
InChIKeyBGSXXISWBJJUFB-UHFFFAOYSA-N
SMILESCC(C)(C)C(=O)OC1=CC2=C(C=C1)NC=C2

Computed by PubChem (NCBI)