Products 2378507-15-2

CAS 2378507-15-2 is the registry number for 3-(2-Aminoethyl)-1H-indole-7-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

3-(2-aminoethyl)-1H-indole-7-carboxylic acid;hydrochloride (CAS 2378507-15-2) is a chemical compound with the molecular formula C11H13ClN2O2 and a molecular weight of 240.68 g/mol. IUPAC name: 3-(2-aminoethyl)-1H-indole-7-carboxylic acid;hydrochloride. InChIKey: YMUCXZLMILIBNB-UHFFFAOYSA-N.

Identity
Molecular formulaC11H13ClN2O2
Molecular weight240.68 g/mol
IUPAC name3-(2-aminoethyl)-1H-indole-7-carboxylic acid;hydrochloride
InChIKeyYMUCXZLMILIBNB-UHFFFAOYSA-N
SMILESC1=CC2=C(C(=C1)C(=O)O)NC=C2CCN.Cl

Computed by PubChem (NCBI)