Products 23789-03-9
CAS 23789-03-9 appears in our catalog under these names: Tetramethyl-d12-ammonium Chloride, 99 atom % D, min 98% Chemical Purity, Tetramethylammonium–d12 chloride, TMA chloride-d12 (chloride), 99.94%. Offered by: CDN, GLPBio, MedChemExpress. Available pack sizes: 0,5g, 100mg, 25mg, 50mg, 100 mg, 25 mg, 50 mg.
Tetrakis(trideuteriomethyl)azanium chloride (CAS 23789-03-9) is a chemical compound with the molecular formula C4H12ClN and a molecular weight of 121.67 g/mol. IUPAC name: tetrakis(trideuteriomethyl)azanium chloride. InChIKey: OKIZCWYLBDKLSU-KXWZVCIVSA-M.
| Molecular formula | C4H12ClN |
|---|---|
| Molecular weight | 121.67 g/mol |
| IUPAC name | tetrakis(trideuteriomethyl)azanium chloride |
| InChIKey | OKIZCWYLBDKLSU-KXWZVCIVSA-M |
| SMILES | [2H]C([2H])([2H])[N+](C([2H])([2H])[2H])(C([2H])([2H])[2H])C([2H])([2H])[2H].[Cl-] |
Computed by PubChem (NCBI)