Products 2733969-46-3
CAS 2733969-46-3 appears in our catalog under these names: N-Isopropyl-N-methylamine-d7 Hydrochloride, N-Methylpropan-2-amine hydrochloride-d7. Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, 250mg, 50mg, 25 mg, 50 mg, 100 mg, 250 mg.
1,1,1,2,3,3,3-heptadeuterio-N-methylpropan-2-amine;hydrochloride (CAS 2733969-46-3) is a chemical compound with the molecular formula C4H12ClN and a molecular weight of 116.64 g/mol. IUPAC name: 1,1,1,2,3,3,3-heptadeuterio-N-methylpropan-2-amine;hydrochloride. InChIKey: GJFBKLLFRJJEQX-PWPMZRLPSA-N.
| Molecular formula | C4H12ClN |
|---|---|
| Molecular weight | 116.64 g/mol |
| IUPAC name | 1,1,1,2,3,3,3-heptadeuterio-N-methylpropan-2-amine;hydrochloride |
| InChIKey | GJFBKLLFRJJEQX-PWPMZRLPSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])NC.Cl |
Computed by PubChem (NCBI)