Products 344298-86-8
CAS 344298-86-8 appears in our catalog under these names: n-Butyl-d9-amine HCl, n-Butyl-d9-amine HCl, 98 atom % D, min 98% Chemical Purity. Offered by: TRC, CDN. Available pack sizes: 10mg, 50mg, 5mg, 0,5g, 0,25g.
1,1,2,2,3,3,4,4,4-nonadeuteriobutan-1-amine;hydrochloride (CAS 344298-86-8) is a chemical compound with the molecular formula C4H12ClN and a molecular weight of 118.65 g/mol. IUPAC name: 1,1,2,2,3,3,4,4,4-nonadeuteriobutan-1-amine;hydrochloride. InChIKey: ICXXXLGATNSZAV-SRKCJUICSA-N.
| Molecular formula | C4H12ClN |
|---|---|
| Molecular weight | 118.65 g/mol |
| IUPAC name | 1,1,2,2,3,3,4,4,4-nonadeuteriobutan-1-amine;hydrochloride |
| InChIKey | ICXXXLGATNSZAV-SRKCJUICSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])N.Cl |
Computed by PubChem (NCBI)