Products 1219805-68-1
CAS 1219805-68-1 is the registry number for Diethyl-2,2,2,2',2',2'-d6-amine HCl, 99 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,5g, 0,25g.
2,2,2-trideuterio-N-(2,2,2-trideuterioethyl)ethanamine;hydrochloride (CAS 1219805-68-1) is a chemical compound with the molecular formula C4H12ClN and a molecular weight of 115.63 g/mol. IUPAC name: 2,2,2-trideuterio-N-(2,2,2-trideuterioethyl)ethanamine;hydrochloride. InChIKey: HDITUCONWLWUJR-TXHXQZCNSA-N.
| Molecular formula | C4H12ClN |
|---|---|
| Molecular weight | 115.63 g/mol |
| IUPAC name | 2,2,2-trideuterio-N-(2,2,2-trideuterioethyl)ethanamine;hydrochloride |
| InChIKey | HDITUCONWLWUJR-TXHXQZCNSA-N |
| SMILES | [2H]C([2H])([2H])CNCC([2H])([2H])[2H].Cl |
Computed by PubChem (NCBI)