Products 2708282-02-2
CAS 2708282-02-2 appears in our catalog under these names: 2-(1-Aminoethyl)-4-fluorophenol hydrochloride, 98%, 2-(1-Aminoethyl)-4-fluorophenol hydrochloride, 98%, 98%. Offered by: Fluorochem, Chemat. Available pack sizes: 10mg, 25mg.
2-(1-aminoethyl)-4-fluorophenol;hydrochloride (CAS 2708282-02-2) is a chemical compound with the molecular formula C8H11ClFNO and a molecular weight of 191.63 g/mol. IUPAC name: 2-(1-aminoethyl)-4-fluorophenol;hydrochloride. InChIKey: WNTRCWFPNVNFGW-UHFFFAOYSA-N.
| Molecular formula | C8H11ClFNO |
|---|---|
| Molecular weight | 191.63 g/mol |
| IUPAC name | 2-(1-aminoethyl)-4-fluorophenol;hydrochloride |
| InChIKey | WNTRCWFPNVNFGW-UHFFFAOYSA-N |
| SMILES | CC(C1=C(C=CC(=C1)F)O)N.Cl |
Computed by PubChem (NCBI)