CAS 2379322-27-5 is the registry number for 4-Methyl-2-(oxazol-5-yl)phenol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.
4-methyl-2-(1,3-oxazol-5-yl)phenol (CAS 2379322-27-5) is a chemical compound with the molecular formula C10H9NO2 and a molecular weight of 175.18 g/mol. IUPAC name: 4-methyl-2-(1,3-oxazol-5-yl)phenol. InChIKey: BOVKWMWPNVMYDU-UHFFFAOYSA-N.
| Molecular formula | C10H9NO2 |
|---|---|
| Molecular weight | 175.18 g/mol |
| IUPAC name | 4-methyl-2-(1,3-oxazol-5-yl)phenol |
| InChIKey | BOVKWMWPNVMYDU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)O)C2=CN=CO2 |
Computed by PubChem (NCBI)