Products 2380775-07-3
CAS 2380775-07-3 is the registry number for 1,3-dimethyl-2-vinylbenzene, >95%. Offered by: Chemat. Available pack sizes: 50mg.
(3R,4S)-4-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid (CAS 2380775-07-3) is a chemical compound with the molecular formula C10H17NO5 and a molecular weight of 231.25 g/mol. IUPAC name: (3R,4S)-4-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid. InChIKey: ZJPHKRGPEONGMA-RNFRBKRXSA-N.
| Molecular formula | C10H17NO5 |
|---|---|
| Molecular weight | 231.25 g/mol |
| IUPAC name | (3R,4S)-4-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid |
| InChIKey | ZJPHKRGPEONGMA-RNFRBKRXSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]([C@@H](C1)O)C(=O)O |
Computed by PubChem (NCBI)