Products 1903430-97-6
CAS 1903430-97-6 appears in our catalog under these names: rel-(3S,4S)-1-(tert-Butoxycarbonyl)-4-hydroxypyrrolidine-3-carboxylic acid, 98%, cis-1-[(tert-butoxy)carbonyl]-4-hydroxypyrrolidine-3-carboxylic acid, 98%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g, 500mg.
(3S,4S)-4-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid (CAS 1903430-97-6) is a chemical compound with the molecular formula C10H17NO5 and a molecular weight of 231.25 g/mol. IUPAC name: (3S,4S)-4-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid. InChIKey: ZJPHKRGPEONGMA-NKWVEPMBSA-N.
| Molecular formula | C10H17NO5 |
|---|---|
| Molecular weight | 231.25 g/mol |
| IUPAC name | (3S,4S)-4-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid |
| InChIKey | ZJPHKRGPEONGMA-NKWVEPMBSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]([C@@H](C1)O)C(=O)O |
Computed by PubChem (NCBI)