CAS 2381263-11-0 is the registry number for 1-(tert-Butyl) 4-methyl (R)-3,4-dihydroquinoline-1,4(2H)-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-O-tert-butyl 4-O-methyl (4R)-3,4-dihydro-2H-quinoline-1,4-dicarboxylate (CAS 2381263-11-0) is a chemical compound with the molecular formula C16H21NO4 and a molecular weight of 291.34 g/mol. IUPAC name: 1-O-tert-butyl 4-O-methyl (4R)-3,4-dihydro-2H-quinoline-1,4-dicarboxylate. InChIKey: UEBDNZMNGUCFOY-GFCCVEGCSA-N.
| Molecular formula | C16H21NO4 |
|---|---|
| Molecular weight | 291.34 g/mol |
| IUPAC name | 1-O-tert-butyl 4-O-methyl (4R)-3,4-dihydro-2H-quinoline-1,4-dicarboxylate |
| InChIKey | UEBDNZMNGUCFOY-GFCCVEGCSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](C2=CC=CC=C21)C(=O)OC |
Computed by PubChem (NCBI)