CAS 2381393-10-6 is the registry number for (R)-1-(4-Chlorophenyl)-2,2,2-trifluoro-N-methylethan-1-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R)-1-(4-chlorophenyl)-2,2,2-trifluoro-N-methylethanamine (CAS 2381393-10-6) is a chemical compound with the molecular formula C9H9ClF3N and a molecular weight of 223.62 g/mol. IUPAC name: (1R)-1-(4-chlorophenyl)-2,2,2-trifluoro-N-methylethanamine. InChIKey: GRHXLLLWHUQZIF-MRVPVSSYSA-N.
| Molecular formula | C9H9ClF3N |
|---|---|
| Molecular weight | 223.62 g/mol |
| IUPAC name | (1R)-1-(4-chlorophenyl)-2,2,2-trifluoro-N-methylethanamine |
| InChIKey | GRHXLLLWHUQZIF-MRVPVSSYSA-N |
| SMILES | CN[C@H](C1=CC=C(C=C1)Cl)C(F)(F)F |
Computed by PubChem (NCBI)