CAS 2382442-97-7 appears in our catalog under these names: Oseltamivir Impurity 178, Oseltamivir Impurity 207, (1S,5R,6S)-5-Isopropoxy-7-oxabicyclo(4.1.0)hept-3-ene-3-carboxylic Acid Ethyl Ester, >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
Ethyl (1S,5R,6S)-5-propan-2-yloxy-7-oxabicyclo[4.1.0]hept-3-ene-3-carboxylate (CAS 2382442-97-7) is a chemical compound with the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. IUPAC name: ethyl (1S,5R,6S)-5-propan-2-yloxy-7-oxabicyclo[4.1.0]hept-3-ene-3-carboxylate. InChIKey: VNIDRCSRWIEVMF-OUAUKWLOSA-N.
| Molecular formula | C12H18O4 |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | ethyl (1S,5R,6S)-5-propan-2-yloxy-7-oxabicyclo[4.1.0]hept-3-ene-3-carboxylate |
| InChIKey | VNIDRCSRWIEVMF-OUAUKWLOSA-N |
| SMILES | CCOC(=O)C1=C[C@H]([C@@H]2[C@H](C1)O2)OC(C)C |
Computed by PubChem (NCBI)