Products 2384386-06-3
CAS 2384386-06-3 is the registry number for Methyl 2-Bromo-3-(difluoromethoxy)benzoate, >95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, 10g.
Methyl 2-bromo-3-(difluoromethoxy)benzoate (CAS 2384386-06-3) is a chemical compound with the molecular formula C9H7BrF2O3 and a molecular weight of 281.05 g/mol. IUPAC name: methyl 2-bromo-3-(difluoromethoxy)benzoate. InChIKey: GRPFSPQNZSQWGP-UHFFFAOYSA-N.
| Molecular formula | C9H7BrF2O3 |
|---|---|
| Molecular weight | 281.05 g/mol |
| IUPAC name | methyl 2-bromo-3-(difluoromethoxy)benzoate |
| InChIKey | GRPFSPQNZSQWGP-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC=C1)OC(F)F)Br |
Computed by PubChem (NCBI)