CAS 1339780-72-1 appears in our catalog under these names: 3-Bromo-4-(2,2-difluoroethoxy)benzoic acid, 95%, 3-Bromo-4-(2,2-difluoroethoxy)benzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-bromo-4-(2,2-difluoroethoxy)benzoic acid (CAS 1339780-72-1) is a chemical compound with the molecular formula C9H7BrF2O3 and a molecular weight of 281.05 g/mol. IUPAC name: 3-bromo-4-(2,2-difluoroethoxy)benzoic acid. InChIKey: QIJZGSPPPKLMTQ-UHFFFAOYSA-N.
| Molecular formula | C9H7BrF2O3 |
|---|---|
| Molecular weight | 281.05 g/mol |
| IUPAC name | 3-bromo-4-(2,2-difluoroethoxy)benzoic acid |
| InChIKey | QIJZGSPPPKLMTQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)Br)OCC(F)F |
Computed by PubChem (NCBI)