CAS 2384425-02-7 is the registry number for 3-Fluoro-2-methoxy-5-(trifluoromethyl)benzoic acid, 98%. Offered by: AmBeed. Available pack sizes: 1g.
3-fluoro-2-methoxy-5-(trifluoromethyl)benzoic acid (CAS 2384425-02-7) is a chemical compound with the molecular formula C9H6F4O3 and a molecular weight of 238.14 g/mol. IUPAC name: 3-fluoro-2-methoxy-5-(trifluoromethyl)benzoic acid. InChIKey: SXJFWZUMGZFRGA-UHFFFAOYSA-N.
| Molecular formula | C9H6F4O3 |
|---|---|
| Molecular weight | 238.14 g/mol |
| IUPAC name | 3-fluoro-2-methoxy-5-(trifluoromethyl)benzoic acid |
| InChIKey | SXJFWZUMGZFRGA-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1F)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)