CAS 2384947-83-3 is the registry number for 1-(tert-Butoxycarbonyl)-4,4-dimethylazetidine-2-carboxylic acid, 98%. Offered by: AmBeed. Available pack sizes: 1g, 250mg.
4,4-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonyl]azetidine-2-carboxylic acid (CAS 2384947-83-3) is a chemical compound with the molecular formula C11H19NO4 and a molecular weight of 229.27 g/mol. IUPAC name: 4,4-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonyl]azetidine-2-carboxylic acid. InChIKey: CAXNMYAPGZFSIG-UHFFFAOYSA-N.
| Molecular formula | C11H19NO4 |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | 4,4-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonyl]azetidine-2-carboxylic acid |
| InChIKey | CAXNMYAPGZFSIG-UHFFFAOYSA-N |
| SMILES | CC1(CC(N1C(=O)OC(C)(C)C)C(=O)O)C |
Computed by PubChem (NCBI)