CAS 2385402-36-6 is the registry number for 2-chloro-5-ethoxy-4-fluorobenzaldehyde, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg.
2-chloro-5-ethoxy-4-fluorobenzaldehyde (CAS 2385402-36-6) is a chemical compound with the molecular formula C9H8ClFO2 and a molecular weight of 202.61 g/mol. IUPAC name: 2-chloro-5-ethoxy-4-fluorobenzaldehyde. InChIKey: MEYIMNSZUKMALU-UHFFFAOYSA-N.
| Molecular formula | C9H8ClFO2 |
|---|---|
| Molecular weight | 202.61 g/mol |
| IUPAC name | 2-chloro-5-ethoxy-4-fluorobenzaldehyde |
| InChIKey | MEYIMNSZUKMALU-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C(=C1)C=O)Cl)F |
Computed by PubChem (NCBI)